Products 303986-90-5
CAS 303986-90-5 is the registry number for (E)-1,1,1-Trifluoro-4-(2-hydroxyanilino)-3-penten-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-1,1,1-trifluoro-4-(2-hydroxyanilino)pent-3-en-2-one (CAS 303986-90-5) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: (E)-1,1,1-trifluoro-4-(2-hydroxyanilino)pent-3-en-2-one. InChIKey: QHESDHPBOHGDLD-VOTSOKGWSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | (E)-1,1,1-trifluoro-4-(2-hydroxyanilino)pent-3-en-2-one |
| InChIKey | QHESDHPBOHGDLD-VOTSOKGWSA-N |
| SMILES | C/C(=C\C(=O)C(F)(F)F)/NC1=CC=CC=C1O |
Computed by PubChem (NCBI)