Products 950476-84-3
CAS 950476-84-3 is the registry number for 4,4,4-Trifluoro-3-hydroxy-3-(4-methoxyphenyl)butanenitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)butanenitrile (CAS 950476-84-3) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: 4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)butanenitrile. InChIKey: QUDQVBKDRCLFCO-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)butanenitrile |
| InChIKey | QUDQVBKDRCLFCO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC#N)(C(F)(F)F)O |
Computed by PubChem (NCBI)