Products 403-34-9
CAS 403-34-9 is the registry number for N-(2-Oxo-2-(4-(trifluoromethyl)phenyl)ethyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
N-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (CAS 403-34-9) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: N-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]acetamide. InChIKey: KLGDOZORQLDUBT-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | N-[2-oxo-2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| InChIKey | KLGDOZORQLDUBT-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)