CAS 15128-61-7 appears in our catalog under these names: 2H,3H,6H,7H,8H-Indeno(5,6-b)(1,4)dioxin-6-one, 2,3,7,8-Tetrahydro-6H-indeno[5,6-b][1,4]dioxin-6-one 95%, 2,3,7,8-Tetrahydro-6H-indeno[5,6-b][1,4]dioxin-6-one, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2,3,7,8-tetrahydrocyclopenta[g][1,4]benzodioxin-6-one (CAS 15128-61-7) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 2,3,7,8-tetrahydrocyclopenta[g][1,4]benzodioxin-6-one. InChIKey: FQOWKJFNVQOKLB-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2,3,7,8-tetrahydrocyclopenta[g][1,4]benzodioxin-6-one |
| InChIKey | FQOWKJFNVQOKLB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC3=C(C=C21)OCCO3 |
Computed by PubChem (NCBI)