CAS 15131-80-3 appears in our catalog under these names: 2,2'-Dihydroxychalcone, 98%, 2,2'-Dihydroxy chalcone/ 98%, 2,2'-Dihydroxychalcone, 2,2′-Dihydroxychalcone, 2,2'-Dihydroxychalcone, min. 95 %, 500 mg. Offered by: Combi-blocks, TargetMol, Biosynth, MedChemExpress, Roth. Available pack sizes: 1g, 10g, 5g, 1mg, 5mg, 10mg, 25mg, 50mg.
(E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one (CAS 15131-80-3) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: (E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: KSHCTKZLHCSARH-MDZDMXLPSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (E)-1,3-bis(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | KSHCTKZLHCSARH-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)C2=CC=CC=C2O)O |
Computed by PubChem (NCBI)