CAS 1514785-94-4 is the registry number for 2,2'-([1,1'-Biphenyl]-4-ylmethylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-phenylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 1514785-94-4) is a chemical compound with the molecular formula C21H18N2 and a molecular weight of 298.4 g/mol. IUPAC name: 2-[(4-phenylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: ZMODSOMIIRUJQI-UHFFFAOYSA-N.
| Molecular formula | C21H18N2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2-[(4-phenylphenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | ZMODSOMIIRUJQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CN3)C4=CC=CN4 |
Computed by PubChem (NCBI)