CAS 73311-46-3 is the registry number for (1E,1'E)-N,N'-(Phenylmethylene)bis(1-phenylmethanimine), 98%. Offered by: AmBeed. Available pack sizes: 25g.
(E)-N-[[(E)-benzylideneamino]-phenylmethyl]-1-phenylmethanimine (CAS 73311-46-3) is a chemical compound with the molecular formula C21H18N2 and a molecular weight of 298.4 g/mol. IUPAC name: (E)-N-[[(E)-benzylideneamino]-phenylmethyl]-1-phenylmethanimine. InChIKey: VUYRFIIFTJICNA-LKNRODPVSA-N.
| Molecular formula | C21H18N2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (E)-N-[[(E)-benzylideneamino]-phenylmethyl]-1-phenylmethanimine |
| InChIKey | VUYRFIIFTJICNA-LKNRODPVSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/C(/N=C/C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)