CAS 1802045-91-5 is the registry number for 1-(2,6-Dimethylphenyl)-2-phenyl-1H-benzo[d]imidazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,6-dimethylphenyl)-2-phenylbenzimidazole (CAS 1802045-91-5) is a chemical compound with the molecular formula C21H18N2 and a molecular weight of 298.4 g/mol. IUPAC name: 1-(2,6-dimethylphenyl)-2-phenylbenzimidazole. InChIKey: SZFKYLYARHXUSE-UHFFFAOYSA-N.
| Molecular formula | C21H18N2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-(2,6-dimethylphenyl)-2-phenylbenzimidazole |
| InChIKey | SZFKYLYARHXUSE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C3=CC=CC=C3N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)