Products 742-01-8
CAS 742-01-8 is the registry number for 1,3,5-Triphenyl-2-pyrazoline. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,5-triphenyl-3,4-dihydropyrazole (CAS 742-01-8) is a chemical compound with the molecular formula C21H18N2 and a molecular weight of 298.4 g/mol. IUPAC name: 2,3,5-triphenyl-3,4-dihydropyrazole. InChIKey: FGCZQOHSWGMVPN-UHFFFAOYSA-N.
| Molecular formula | C21H18N2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2,3,5-triphenyl-3,4-dihydropyrazole |
| InChIKey | FGCZQOHSWGMVPN-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Luminor 8, 1H-Pyrazole, 4,5-dihydro-1,3,5-triphenyl-, Luminor Red-Violet 440 RT, Red-Violet 440 RT, 4,5-Dihydro-1,3,5-triphenyl-1H-pyrazole, Luminofor Red-Violet 440 RT, 2-Pyrazoline, 1,3,5-triphenyl-(6CI,8CI), 1,3,5-Triphenylpyrazoline, 1,3,5-Triphenyl-4,5-dihydro-1H-pyrazole, 1,3,5-triphenyl-2-pyrazoline