CAS 37867-75-7 is the registry number for 6-(4-N,N-Dimethylaminophenyl)-phenanthridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N,N-dimethyl-4-phenanthridin-6-ylaniline (CAS 37867-75-7) is a chemical compound with the molecular formula C21H18N2 and a molecular weight of 298.4 g/mol. IUPAC name: N,N-dimethyl-4-phenanthridin-6-ylaniline. InChIKey: GUNJAKUTKIFMFJ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | N,N-dimethyl-4-phenanthridin-6-ylaniline |
| InChIKey | GUNJAKUTKIFMFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)