CAS 15169-02-5 is the registry number for 1–bromo–3–(methyl–d3)benzene. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
1-bromo-3-(trideuteriomethyl)benzene (CAS 15169-02-5) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 174.05 g/mol. IUPAC name: 1-bromo-3-(trideuteriomethyl)benzene. InChIKey: WJIFKOVZNJTSGO-FIBGUPNXSA-N.
| Molecular formula | C7H7Br |
|---|---|
| Molecular weight | 174.05 g/mol |
| IUPAC name | 1-bromo-3-(trideuteriomethyl)benzene |
| InChIKey | WJIFKOVZNJTSGO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)