Products 1518080-72-2
CAS 1518080-72-2 is the registry number for 5-amino-N-(2,6-dioxopiperidin-3-yl)picolinamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-amino-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide (CAS 1518080-72-2) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 5-amino-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide. InChIKey: YZYFNRKMEMEQFC-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 5-amino-N-(2,6-dioxopiperidin-3-yl)pyridine-2-carboxamide |
| InChIKey | YZYFNRKMEMEQFC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)