CAS 1781934-11-9 is the registry number for 5-Cyclopentyl-7-oxo-6,7-dihydro-1H-pyrazolo[4,3-d]pyrimidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyclopentyl-7-oxo-2,6-dihydropyrazolo[4,3-d]pyrimidine-3-carboxylic acid (CAS 1781934-11-9) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 5-cyclopentyl-7-oxo-2,6-dihydropyrazolo[4,3-d]pyrimidine-3-carboxylic acid. InChIKey: ILXJOIGYYBECQP-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 5-cyclopentyl-7-oxo-2,6-dihydropyrazolo[4,3-d]pyrimidine-3-carboxylic acid |
| InChIKey | ILXJOIGYYBECQP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC3=C(NN=C3C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)