CAS 540514-18-9 is the registry number for (9-Oxo-4,5,6,7,8,9-hexahydro-[1,2,4]triazolo-[5,1-b]quinazolin-2-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(9-oxo-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl)acetic acid (CAS 540514-18-9) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 2-(9-oxo-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl)acetic acid. InChIKey: CSRJCSXOPMYRSO-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 2-(9-oxo-5,6,7,8-tetrahydro-1H-[1,2,4]triazolo[5,1-b]quinazolin-2-yl)acetic acid |
| InChIKey | CSRJCSXOPMYRSO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N3C(=N2)N=C(N3)CC(=O)O |
Computed by PubChem (NCBI)