Products 37090-34-9

CAS 37090-34-9 is the registry number for 3-(5-(3-Methoxyphenyl)-2H-tetrazol-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[5-(3-methoxyphenyl)tetrazol-2-yl]propanoic acid (CAS 37090-34-9) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 3-[5-(3-methoxyphenyl)tetrazol-2-yl]propanoic acid. InChIKey: FOLOXXVSMPWNFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N4O3
Molecular weight248.24 g/mol
IUPAC name3-[5-(3-methoxyphenyl)tetrazol-2-yl]propanoic acid
InChIKeyFOLOXXVSMPWNFJ-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)C2=NN(N=N2)CCC(=O)O

Computed by PubChem (NCBI)