Products 1098365-67-3

CAS 1098365-67-3 appears in our catalog under these names: 4-(1H-1,2,3-Benzotriazol-5-ylformamido)butanoic acid, 95%, 4-(1H-1,2,3-Benzotriazol-5-ylformamido)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(2H-benzotriazole-5-carbonylamino)butanoic acid (CAS 1098365-67-3) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: 4-(2H-benzotriazole-5-carbonylamino)butanoic acid. InChIKey: JIUIGLKVQFAWKN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N4O3
Molecular weight248.24 g/mol
IUPAC name4-(2H-benzotriazole-5-carbonylamino)butanoic acid
InChIKeyJIUIGLKVQFAWKN-UHFFFAOYSA-N
SMILESC1=CC2=NNN=C2C=C1C(=O)NCCCC(=O)O

Computed by PubChem (NCBI)