CAS 85779-74-4 is the registry number for Methyl 5-amino-1-(4-methoxyphenyl)-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g, 25g.
Methyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate (CAS 85779-74-4) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: methyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate. InChIKey: PLFKTDVYHSCDFX-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | methyl 5-amino-1-(4-methoxyphenyl)triazole-4-carboxylate |
| InChIKey | PLFKTDVYHSCDFX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=C(N=N2)C(=O)OC)N |
Computed by PubChem (NCBI)