CAS 1519455-25-4 appears in our catalog under these names: 3-(2,2-Difluoro-1,3-dioxaindan-5-yl)propanoic acid, 95%, 3-(2,2-Difluoro-1,3-dioxaindan-5-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid (CAS 1519455-25-4) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: 3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid. InChIKey: MQYASWNSYMYWRG-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O4 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 3-(2,2-difluoro-1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | MQYASWNSYMYWRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCC(=O)O)OC(O2)(F)F |
Computed by PubChem (NCBI)