Products 2663953-33-9

CAS 2663953-33-9 is the registry number for 3-(2,5-Difluoro-4-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,5-difluoro-4-methoxyphenyl)-2-oxopropanoic acid (CAS 2663953-33-9) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: 3-(2,5-difluoro-4-methoxyphenyl)-2-oxopropanoic acid. InChIKey: RXQZTDGRGXDOTH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F2O4
Molecular weight230.16 g/mol
IUPAC name3-(2,5-difluoro-4-methoxyphenyl)-2-oxopropanoic acid
InChIKeyRXQZTDGRGXDOTH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)F)CC(=O)C(=O)O)F

Computed by PubChem (NCBI)