CAS 2667543-48-6 is the registry number for 3-(2,3-Difluoro-6-methoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,3-difluoro-6-methoxyphenyl)-2-oxopropanoic acid (CAS 2667543-48-6) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: 3-(2,3-difluoro-6-methoxyphenyl)-2-oxopropanoic acid. InChIKey: ROOXZELIZPXMMN-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O4 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | 3-(2,3-difluoro-6-methoxyphenyl)-2-oxopropanoic acid |
| InChIKey | ROOXZELIZPXMMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)CC(=O)C(=O)O |
Computed by PubChem (NCBI)