Products 953893-43-1

CAS 953893-43-1 is the registry number for 3-(4-(Difluoromethoxy)phenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[4-(difluoromethoxy)phenyl]-2-oxopropanoic acid (CAS 953893-43-1) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: 3-[4-(difluoromethoxy)phenyl]-2-oxopropanoic acid. InChIKey: RYKPJXLMZNAQJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F2O4
Molecular weight230.16 g/mol
IUPAC name3-[4-(difluoromethoxy)phenyl]-2-oxopropanoic acid
InChIKeyRYKPJXLMZNAQJZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)C(=O)O)OC(F)F

Computed by PubChem (NCBI)