CAS 157489-19-5 is the registry number for Ethyl 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate (CAS 157489-19-5) is a chemical compound with the molecular formula C10H8F2O4 and a molecular weight of 230.16 g/mol. IUPAC name: ethyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate. InChIKey: HUORHOPYFMYBFE-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O4 |
|---|---|
| Molecular weight | 230.16 g/mol |
| IUPAC name | ethyl 2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| InChIKey | HUORHOPYFMYBFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)