Products 1519880-49-9

CAS 1519880-49-9 is the registry number for 5-(Methoxycarbonyl)-1,2-oxazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methoxycarbonyl-1,2-oxazole-3-carboxylic acid (CAS 1519880-49-9) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methoxycarbonyl-1,2-oxazole-3-carboxylic acid. InChIKey: KBAOVIWEXKKXHA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO5
Molecular weight171.11 g/mol
IUPAC name5-methoxycarbonyl-1,2-oxazole-3-carboxylic acid
InChIKeyKBAOVIWEXKKXHA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NO1)C(=O)O

Computed by PubChem (NCBI)