CAS 855404-45-4 appears in our catalog under these names: B498358, 2-Methyl-1,3-oxazole-4,5-dicarboxylic acid, 95%, 2-Methyl-1,3-oxazole-4,5-dicarboxylic acid. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 500mg, 1g, 50mg, 0,5g.
2-methyl-1,3-oxazole-4,5-dicarboxylic acid (CAS 855404-45-4) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 2-methyl-1,3-oxazole-4,5-dicarboxylic acid. InChIKey: OIYQJZAGTOCYLA-UHFFFAOYSA-N.
| Molecular formula | C6H5NO5 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 2-methyl-1,3-oxazole-4,5-dicarboxylic acid |
| InChIKey | OIYQJZAGTOCYLA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)