Products 326867-81-6

CAS 326867-81-6 is the registry number for 5-Methyl-4-nitrofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methyl-4-nitrofuran-2-carboxylic acid (CAS 326867-81-6) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methyl-4-nitrofuran-2-carboxylic acid. InChIKey: LXJRLXXVMGGAGC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO5
Molecular weight171.11 g/mol
IUPAC name5-methyl-4-nitrofuran-2-carboxylic acid
InChIKeyLXJRLXXVMGGAGC-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)