CAS 326867-81-6 is the registry number for 5-Methyl-4-nitrofuran-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methyl-4-nitrofuran-2-carboxylic acid (CAS 326867-81-6) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methyl-4-nitrofuran-2-carboxylic acid. InChIKey: LXJRLXXVMGGAGC-UHFFFAOYSA-N.
| Molecular formula | C6H5NO5 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 5-methyl-4-nitrofuran-2-carboxylic acid |
| InChIKey | LXJRLXXVMGGAGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)