CAS 198135-45-4 is the registry number for 5-Methylisoxazole-3,4-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-1,2-oxazole-3,4-dicarboxylic acid (CAS 198135-45-4) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methyl-1,2-oxazole-3,4-dicarboxylic acid. InChIKey: UDEVDMXIMWDTJE-UHFFFAOYSA-N.
| Molecular formula | C6H5NO5 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 5-methyl-1,2-oxazole-3,4-dicarboxylic acid |
| InChIKey | UDEVDMXIMWDTJE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)