Products 198135-45-4

CAS 198135-45-4 is the registry number for 5-Methylisoxazole-3,4-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-1,2-oxazole-3,4-dicarboxylic acid (CAS 198135-45-4) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 5-methyl-1,2-oxazole-3,4-dicarboxylic acid. InChIKey: UDEVDMXIMWDTJE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO5
Molecular weight171.11 g/mol
IUPAC name5-methyl-1,2-oxazole-3,4-dicarboxylic acid
InChIKeyUDEVDMXIMWDTJE-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)