Products 178315-16-7

CAS 178315-16-7 is the registry number for 3-Methylisoxazole-4,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-methyl-1,2-oxazole-4,5-dicarboxylic acid (CAS 178315-16-7) is a chemical compound with the molecular formula C6H5NO5 and a molecular weight of 171.11 g/mol. IUPAC name: 3-methyl-1,2-oxazole-4,5-dicarboxylic acid. InChIKey: PMPPVMJSTKRCSC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO5
Molecular weight171.11 g/mol
IUPAC name3-methyl-1,2-oxazole-4,5-dicarboxylic acid
InChIKeyPMPPVMJSTKRCSC-UHFFFAOYSA-N
SMILESCC1=NOC(=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)