Products 1520481-67-7
CAS 1520481-67-7 is the registry number for 1-(2,3-Dichloro-6-fluorophenyl)-2,2,2-trifluoroethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethanone (CAS 1520481-67-7) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: KJUOYEDVKQYVKR-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F4O |
|---|---|
| Molecular weight | 261.00 g/mol |
| IUPAC name | 1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | KJUOYEDVKQYVKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)