Products 186517-45-3
CAS 186517-45-3 appears in our catalog under these names: 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoylchloride, 3-Chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride (CAS 186517-45-3) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 3-chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride. InChIKey: QRJJXSXDJDIRPI-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F4O |
|---|---|
| Molecular weight | 261.00 g/mol |
| IUPAC name | 3-chloro-2-fluoro-6-(trifluoromethyl)benzoyl chloride |
| InChIKey | QRJJXSXDJDIRPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C(=O)Cl)F)Cl |
Computed by PubChem (NCBI)