CAS 1879995-18-2 is the registry number for 2-chloro-1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone (CAS 1879995-18-2) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 2-chloro-1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone. InChIKey: MNYVGAYYVHJIIL-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F4O |
|---|---|
| Molecular weight | 261.00 g/mol |
| IUPAC name | 2-chloro-1-(6-chloro-2,3-difluorophenyl)-2,2-difluoroethanone |
| InChIKey | MNYVGAYYVHJIIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)C(=O)C(F)(F)Cl)Cl |
Computed by PubChem (NCBI)