CAS 1855930-67-4 is the registry number for 2-Chloro-3-fluoro-4-(trifluoromethyl)benzoyl chloride. Offered by: TRC. Available pack sizes: 1g.
2-chloro-3-fluoro-4-(trifluoromethyl)benzoyl chloride (CAS 1855930-67-4) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 2-chloro-3-fluoro-4-(trifluoromethyl)benzoyl chloride. InChIKey: OBJBKFPIPDQGME-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F4O |
|---|---|
| Molecular weight | 261.00 g/mol |
| IUPAC name | 2-chloro-3-fluoro-4-(trifluoromethyl)benzoyl chloride |
| InChIKey | OBJBKFPIPDQGME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)