CAS 261763-03-5 is the registry number for 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride (CAS 261763-03-5) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride. InChIKey: WWXKIEVIKMYSCL-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F4O |
|---|---|
| Molecular weight | 261.00 g/mol |
| IUPAC name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | WWXKIEVIKMYSCL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)Cl)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)