Products 261763-03-5

CAS 261763-03-5 is the registry number for 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride (CAS 261763-03-5) is a chemical compound with the molecular formula C8H2Cl2F4O and a molecular weight of 261.00 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride. InChIKey: WWXKIEVIKMYSCL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H2Cl2F4O
Molecular weight261.00 g/mol
IUPAC name3-chloro-2-fluoro-5-(trifluoromethyl)benzoyl chloride
InChIKeyWWXKIEVIKMYSCL-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)Cl)F)Cl)C(F)(F)F

Computed by PubChem (NCBI)