Products 1520651-44-8

CAS 1520651-44-8 is the registry number for 2-(4-tert-Butylcyclohexyl)-2-hydroxyacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(4-tert-butylcyclohexyl)-2-hydroxyacetic acid (CAS 1520651-44-8) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(4-tert-butylcyclohexyl)-2-hydroxyacetic acid. InChIKey: LMASIWKHEKAGMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22O3
Molecular weight214.30 g/mol
IUPAC name2-(4-tert-butylcyclohexyl)-2-hydroxyacetic acid
InChIKeyLMASIWKHEKAGMQ-UHFFFAOYSA-N
SMILESCC(C)(C)C1CCC(CC1)C(C(=O)O)O

Computed by PubChem (NCBI)