Products 1522241-50-4
CAS 1522241-50-4 is the registry number for tert-Butyl N-((2R)-4-chloro-3-oxobutan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Tert-butyl N-[(2R)-4-chloro-3-oxobutan-2-yl]carbamate (CAS 1522241-50-4) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: tert-butyl N-[(2R)-4-chloro-3-oxobutan-2-yl]carbamate. InChIKey: SUMIWORFUZTLFW-ZCFIWIBFSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | tert-butyl N-[(2R)-4-chloro-3-oxobutan-2-yl]carbamate |
| InChIKey | SUMIWORFUZTLFW-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)CCl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)