CAS 152237-40-6 appears in our catalog under these names: Levodropropizine N-Oxide, (S)-(-)-Dropropizine N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 50mg.
(2S)-3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol (CAS 152237-40-6) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: (2S)-3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol. InChIKey: PLWDVKPSKVPUMW-ZDUSSCGKSA-N.
| Molecular formula | C13H20N2O3 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | (2S)-3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol |
| InChIKey | PLWDVKPSKVPUMW-ZDUSSCGKSA-N |
| SMILES | C1C[N+](CCN1C2=CC=CC=C2)(C[C@@H](CO)O)[O-] |
Computed by PubChem (NCBI)