CAS 152323-00-7 appears in our catalog under these names: Dropropizine Impurity 1, Dropropizine N-Oxide. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol (CAS 152323-00-7) is a chemical compound with the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. IUPAC name: 3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol. InChIKey: PLWDVKPSKVPUMW-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 3-(1-oxido-4-phenylpiperazin-1-ium-1-yl)propane-1,2-diol |
| InChIKey | PLWDVKPSKVPUMW-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C2=CC=CC=C2)(CC(CO)O)[O-] |
Computed by PubChem (NCBI)