Products 1523571-07-4

CAS 1523571-07-4 appears in our catalog under these names: tert-Butyl 2,5-diazaspiro(3.5)nonane-5-carboxylate oxalate(2:1), 97%, tert-Butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate oxalate(2:1), 97%, 97%, tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate hemioxalate, 97%, tert-Butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate oxalate(2:1), 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate);oxalic acid (CAS 1523571-07-4) is a chemical compound with the molecular formula C26H46N4O8 and a molecular weight of 542.7 g/mol. IUPAC name: bis(tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate);oxalic acid. InChIKey: SVACKVJTQHYNHY-UHFFFAOYSA-N.

Identity
Molecular formulaC26H46N4O8
Molecular weight542.7 g/mol
IUPAC namebis(tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate);oxalic acid
InChIKeySVACKVJTQHYNHY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC12CNC2.CC(C)(C)OC(=O)N1CCCCC12CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)