CAS 1523618-26-9 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro(3.5)nonane-6-carboxylate oxalate(2:1), 97%, 2,6-Diazaspiro[3.5]nonane-6-carboxylic acid, 1,1-dimethylethyl ester, ethanedioate (2:1), 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g.
Bis(tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate);oxalic acid (CAS 1523618-26-9) is a chemical compound with the molecular formula C26H46N4O8 and a molecular weight of 542.7 g/mol. IUPAC name: bis(tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate);oxalic acid. InChIKey: XEIYRMZIEKPZDK-UHFFFAOYSA-N.
| Molecular formula | C26H46N4O8 |
|---|---|
| Molecular weight | 542.7 g/mol |
| IUPAC name | bis(tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate);oxalic acid |
| InChIKey | XEIYRMZIEKPZDK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CNC2.CC(C)(C)OC(=O)N1CCCC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)