Products 1788041-41-7

CAS 1788041-41-7 is the registry number for tert-Butyl 1,7-diazaspiro[4.4]nonane-1-carboxylate hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 1,7-diazaspiro[4.4]nonane-1-carboxylate);oxalic acid (CAS 1788041-41-7) is a chemical compound with the molecular formula C26H46N4O8 and a molecular weight of 542.7 g/mol. IUPAC name: bis(tert-butyl 1,7-diazaspiro[4.4]nonane-1-carboxylate);oxalic acid. InChIKey: JRYLKYZYHBIATF-UHFFFAOYSA-N.

Identity
Molecular formulaC26H46N4O8
Molecular weight542.7 g/mol
IUPAC namebis(tert-butyl 1,7-diazaspiro[4.4]nonane-1-carboxylate);oxalic acid
InChIKeyJRYLKYZYHBIATF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC12CCNC2.CC(C)(C)OC(=O)N1CCCC12CCNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)