CAS 1630906-45-4 appears in our catalog under these names: tert-Butyl 1,6-diazaspiro[3.5]nonane-6-carboxylate hemioxalate, 95%, tert–Butyl 1,6–diazaspiro(3·5)nonane–6–carboxylate oxalate(2:1), tert-Butyl 1,6-diazaspiro[3.5]nonane-6-carboxylate oxalate(2:1), 97%, 97%, tert-butyl 1,6-diazaspiro[3.5]nonane-6-carboxylate hemioxalate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 25mg, 100mg.
Bis(tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid (CAS 1630906-45-4) is a chemical compound with the molecular formula C26H46N4O8 and a molecular weight of 542.7 g/mol. IUPAC name: bis(tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid. InChIKey: WTODIOPHLRZZTM-UHFFFAOYSA-N.
| Molecular formula | C26H46N4O8 |
|---|---|
| Molecular weight | 542.7 g/mol |
| IUPAC name | bis(tert-butyl 1,8-diazaspiro[3.5]nonane-8-carboxylate);oxalic acid |
| InChIKey | WTODIOPHLRZZTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCN2.CC(C)(C)OC(=O)N1CCCC2(C1)CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)