CAS 1788054-69-2 appears in our catalog under these names: tert-Butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate oxalate(2:1), Oxalic acid bis(tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate), 95%, tert-butyl 2,7-diazaspiro(4.4)nonane-2-carboxylate hemioxalate, 97%, tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate hemioxalate, 97%, 97%. Offered by: MedChemExpress, Combi-blocks, AmBeed, Chemat. Available pack sizes: Get quote, 25g, 1g, 5g.
Bis(tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid (CAS 1788054-69-2) is a chemical compound with the molecular formula C26H46N4O8 and a molecular weight of 542.7 g/mol. IUPAC name: bis(tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid. InChIKey: BGYVZWTVFPYPSY-UHFFFAOYSA-N.
| Molecular formula | C26H46N4O8 |
|---|---|
| Molecular weight | 542.7 g/mol |
| IUPAC name | bis(tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate);oxalic acid |
| InChIKey | BGYVZWTVFPYPSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCNC2.CC(C)(C)OC(=O)N1CCC2(C1)CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)