CAS 1523618-34-9 is the registry number for (1-Tosylpiperidine-4,4-diyl)dimethanol, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
[4-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpiperidin-4-yl]methanol (CAS 1523618-34-9) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: [4-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpiperidin-4-yl]methanol. InChIKey: SSPZMXLYVPOWNY-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | [4-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpiperidin-4-yl]methanol |
| InChIKey | SSPZMXLYVPOWNY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)(CO)CO |
Computed by PubChem (NCBI)