CAS 790272-20-7 is the registry number for 3-Pentamethylbenzenesulfonamidopropanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid (CAS 790272-20-7) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid. InChIKey: BEQWJZCWFUCKIS-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid |
| InChIKey | BEQWJZCWFUCKIS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)S(=O)(=O)NCCC(=O)O)C)C |
Computed by PubChem (NCBI)