Products 790272-20-7

CAS 790272-20-7 is the registry number for 3-Pentamethylbenzenesulfonamidopropanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid (CAS 790272-20-7) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid. InChIKey: BEQWJZCWFUCKIS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO4S
Molecular weight299.39 g/mol
IUPAC name3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid
InChIKeyBEQWJZCWFUCKIS-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1C)C)S(=O)(=O)NCCC(=O)O)C)C

Computed by PubChem (NCBI)