Products 2479971-29-2
CAS 2479971-29-2 is the registry number for CliCr®-Suc. Offered by: Iris Biotech. Available pack sizes: 10mg, 25mg, 50mg.
4-oxo-4-[(3,3,6,6-tetramethyl-1-oxo-1lambda6-thiacyclohept-4-yn-1-ylidene)amino]butanoic acid (CAS 2479971-29-2) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: 4-oxo-4-[(3,3,6,6-tetramethyl-1-oxo-1lambda6-thiacyclohept-4-yn-1-ylidene)amino]butanoic acid. InChIKey: BCJVPVWQKDBDRV-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 4-oxo-4-[(3,3,6,6-tetramethyl-1-oxo-1lambda6-thiacyclohept-4-yn-1-ylidene)amino]butanoic acid |
| InChIKey | BCJVPVWQKDBDRV-UHFFFAOYSA-N |
| SMILES | CC1(CS(=NC(=O)CCC(=O)O)(=O)CC(C#C1)(C)C)C |
Computed by PubChem (NCBI)