Products 152367-54-9
CAS 152367-54-9 is the registry number for EGR-1-IN-2, 99.61%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg, 50 mg.
1-[5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol (CAS 152367-54-9) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 1-[5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol. InChIKey: QTUIYOWSYGRGCB-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-[5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol |
| InChIKey | QTUIYOWSYGRGCB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=NN2)C3=C(C=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)