CAS 152434-87-2 appears in our catalog under these names: 2,6-Difluoro-3-(phenylmethoxy)benzaldehyde, 95%, 3-(Benzyloxy)-2,6-difluorobenzaldehyde, 97%, 2,6-Difluoro-3-(phenylmethoxy)benzaldehyde, ≥95%, ≥95%, 2,6-Difluoro-3-(phenylmethoxy)benzaldehyde. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2,6-difluoro-3-phenylmethoxybenzaldehyde (CAS 152434-87-2) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,6-difluoro-3-phenylmethoxybenzaldehyde. InChIKey: XUDRVEHXMYKFEF-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,6-difluoro-3-phenylmethoxybenzaldehyde |
| InChIKey | XUDRVEHXMYKFEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)C=O)F |
Computed by PubChem (NCBI)