CAS 152468-91-2 appears in our catalog under these names: (R)-Boc-2-Vinyl-Gly-OH, 95%, (2R)-2-{((tert-Butoxy)carbonyl)amino}but-3-enoic acid, (R)-2-((tert-Butoxycarbonyl)amino)but-3-enoic acid, 95%, 95%. Offered by: Ambeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid (CAS 152468-91-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid. InChIKey: BYHZVVBUNVWRGH-ZCFIWIBFSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
| InChIKey | BYHZVVBUNVWRGH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=C)C(=O)O |
Computed by PubChem (NCBI)