CAS 91028-39-6 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)but-3-enoic acid, 95%, 95%, 3-Butenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2S)-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid (CAS 91028-39-6) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid. InChIKey: BYHZVVBUNVWRGH-LURJTMIESA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
| InChIKey | BYHZVVBUNVWRGH-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C=C)C(=O)O |
Computed by PubChem (NCBI)