CAS 152494-76-3 is the registry number for Edaravone Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-methyl-1-oxido-2-phenyl-4H-pyrazol-1-ium-3-one (CAS 152494-76-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 5-methyl-1-oxido-2-phenyl-4H-pyrazol-1-ium-3-one. InChIKey: XHAFWWKZDDIGRS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-methyl-1-oxido-2-phenyl-4H-pyrazol-1-ium-3-one |
| InChIKey | XHAFWWKZDDIGRS-UHFFFAOYSA-N |
| SMILES | CC1=[N+](N(C(=O)C1)C2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)