CAS 1525433-40-2 is the registry number for 2-Nitro-3-(phenylsulfanyl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-nitro-3-phenylsulfanylaniline (CAS 1525433-40-2) is a chemical compound with the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. IUPAC name: 2-nitro-3-phenylsulfanylaniline. InChIKey: JDFGCWQJPMUGEK-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2S |
|---|---|
| Molecular weight | 246.29 g/mol |
| IUPAC name | 2-nitro-3-phenylsulfanylaniline |
| InChIKey | JDFGCWQJPMUGEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC(=C2[N+](=O)[O-])N |
Computed by PubChem (NCBI)